C16H18ClN3O4 — CID 8604097
[(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 5-chloro-2-hydroxybenzoate (PubChem CID 8604097) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8604097 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 5-chloro-2-hydroxybenzoate |
| SMILES | CC(C)n1nccc1NC(=O)[C@H](C)OC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H18ClN3O4/c1-9(2)20-14(6-7-18-20)19-15(22)10(3)24-16(23)12-8-11(17)4-5-13(12)21/h4-10,21H,1-3H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | DLXRNDTWILRDIR-JTQLQIEISA-N |
| XLogP | 3.01 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |