C17H20ClN3O4 — CID 8908561
[(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(2-chlorophenoxy)acetate (PubChem CID 8908561) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(2-chlorophenoxy)acetate.
| Compound Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8908561 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(2-chlorophenoxy)acetate |
| SMILES | CC(C)n1nccc1NC(=O)[C@H](C)OC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C17H20ClN3O4/c1-11(2)21-15(8-9-19-21)20-17(23)12(3)25-16(22)10-24-14-7-5-4-6-13(14)18/h4-9,11-12H,10H2,1-3H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | DJVIZDOVEOUDMU-LBPRGKRZSA-N |
| XLogP | 3.07 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |