C17H20FN3O3 — CID 8612742
[(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(4-fluorophenyl)acetate (PubChem CID 8612742) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(4-fluorophenyl)acetate.
| Compound Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8612742 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [(2S)-1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 2-(4-fluorophenyl)acetate |
| SMILES | CC(C)n1nccc1NC(=O)[C@H](C)OC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3O3/c1-11(2)21-15(8-9-19-21)20-17(23)12(3)24-16(22)10-13-4-6-14(18)7-5-13/h4-9,11-12H,10H2,1-3H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | DNAKFUORFWGVOV-LBPRGKRZSA-N |
| XLogP | 2.72 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |