C19H23Cl2N3O4 — CID 42981657
[1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 42981657) has the molecular formula C19H23Cl2N3O4 and a molecular weight of 428.32 g/mol. Its IUPAC name is [1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 42981657 |
| Molecular Formula | C19H23Cl2N3O4 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [1-oxo-1-[(2-propan-2-ylpyrazol-3-yl)amino]propan-2-yl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | CC(OC(=O)CCCOc1ccc(Cl)cc1Cl)C(=O)Nc1ccnn1C(C)C |
| InChI | InChI=1S/C19H23Cl2N3O4/c1-12(2)24-17(8-9-22-24)23-19(26)13(3)28-18(25)5-4-10-27-16-7-6-14(20)11-15(16)21/h6-9,11-13H,4-5,10H2,1-3H3,(H,23,26) |
| InChIKey | BTMGZBMCWMOVBF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|