C15H14N2O6 — CID 7553067
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7553067) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7553067 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(O)c2ccccc2c1O)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H14N2O6/c1-7(13(20)17-15(16)22)23-14(21)10-6-11(18)8-4-2-3-5-9(8)12(10)19/h2-7,18-19H,1H3,(H3,16,17,20,22)/t7-/m0/s1 |
| InChIKey | JXYXJHOFUKWFQK-ZETCQYMHSA-N |
| XLogP | 0.99 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|