C20H16FNO5 — CID 7228552
[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7228552) has the molecular formula C20H16FNO5 and a molecular weight of 369.35 g/mol. Its IUPAC name is [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7228552 |
| Molecular Formula | C20H16FNO5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(O)c2ccccc2c1O)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C20H16FNO5/c1-11(19(25)22-16-9-5-4-8-15(16)21)27-20(26)14-10-17(23)12-6-2-3-7-13(12)18(14)24/h2-11,23-24H,1H3,(H,22,25)/t11-/m0/s1 |
| InChIKey | HNCPBPJWVAKYHS-NSHDSACASA-N |
| XLogP | 3.57 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|