C22H19NO7 — CID 7553047
[(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7553047) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7553047 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(O)c2ccccc2c1O)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19NO7/c1-12(21(26)23-10-13-6-7-18-19(8-13)29-11-28-18)30-22(27)16-9-17(24)14-4-2-3-5-15(14)20(16)25/h2-9,12,24-25H,10-11H2,1H3,(H,23,26)/t12-/m0/s1 |
| InChIKey | MZBOBYPJKSLEBH-LBPRGKRZSA-N |
| XLogP | 2.84 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|