C21H17NO7 — CID 7785531
[(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate (PubChem CID 7785531) has the molecular formula C21H17NO7 and a molecular weight of 395.37 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 7785531 |
| Molecular Formula | C21H17NO7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-oxochromene-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc2ccccc2oc1=O)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H17NO7/c1-12(19(23)22-10-13-6-7-17-18(8-13)27-11-26-17)28-20(24)15-9-14-4-2-3-5-16(14)29-21(15)25/h2-9,12H,10-11H2,1H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | VRBQOMFPKXVEKN-GFCCVEGCSA-N |
| XLogP | 2.38 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|