C18H14ClF2NO5 — CID 3993953
[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 3993953) has the molecular formula C18H14ClF2NO5 and a molecular weight of 397.76 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 3993953 |
| Molecular Formula | C18H14ClF2NO5 |
| Molecular Weight | 397.76 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | CC(OC(=O)c1cc(F)c(F)cc1Cl)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14ClF2NO5/c1-9(27-18(24)11-5-13(20)14(21)6-12(11)19)17(23)22-7-10-2-3-15-16(4-10)26-8-25-15/h2-6,9H,7-8H2,1H3,(H,22,23) |
| InChIKey | LYKRSNPXTLHILB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|