C18H17FN2O5 — CID 17392333
[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate (PubChem CID 17392333) has the molecular formula C18H17FN2O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate.
| Compound Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 17392333 |
| Molecular Formula | C18H17FN2O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 2-amino-4-fluorobenzoate |
| SMILES | CC(OC(=O)c1ccc(F)cc1N)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17FN2O5/c1-10(26-18(23)13-4-3-12(19)7-14(13)20)17(22)21-8-11-2-5-15-16(6-11)25-9-24-15/h2-7,10H,8-9,20H2,1H3,(H,21,22) |
| InChIKey | SCERALJFJYJURS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|