C12H14F2O6S — CID 155323469
1,1-difluoro-2-(4-hydroxy-3,5-dimethylbenzoyl)oxypropane-1-sulfonic acid (PubChem CID 155323469) has the molecular formula C12H14F2O6S and a molecular weight of 324.30 g/mol. Its IUPAC name is 1,1-difluoro-2-(4-hydroxy-3,5-dimethylbenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1-difluoro-2-(4-hydroxy-3,5-dimethylbenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 155323469 |
| Molecular Formula | C12H14F2O6S |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1,1-difluoro-2-(4-hydroxy-3,5-dimethylbenzoyl)oxypropane-1-sulfonic acid |
| SMILES | Cc1cc(C(=O)OC(C)C(F)(F)S(=O)(=O)O)cc(C)c1O |
| InChI | InChI=1S/C12H14F2O6S/c1-6-4-9(5-7(2)10(6)15)11(16)20-8(3)12(13,14)21(17,18)19/h4-5,8,15H,1-3H3,(H,17,18,19) |
| InChIKey | IXWZUWAZLYHWEN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|