C14H18F2O8S — CID 166895901
1,1-difluoro-2-hydroxy-2-[2-[3-(2-hydroxy-2-methylpropyl)phenoxy]acetyl]oxyethanesulfonic acid (PubChem CID 166895901) has the molecular formula C14H18F2O8S and a molecular weight of 384.35 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxy-2-[2-[3-(2-hydroxy-2-methylpropyl)phenoxy]acetyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-hydroxy-2-[2-[3-(2-hydroxy-2-methylpropyl)phenoxy]acetyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166895901 |
| Molecular Formula | C14H18F2O8S |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1,1-difluoro-2-hydroxy-2-[2-[3-(2-hydroxy-2-methylpropyl)phenoxy]acetyl]oxyethanesulfonic acid |
| SMILES | CC(C)(O)Cc1cccc(OCC(=O)OC(O)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H18F2O8S/c1-13(2,19)7-9-4-3-5-10(6-9)23-8-11(17)24-12(18)14(15,16)25(20,21)22/h3-6,12,18-19H,7-8H2,1-2H3,(H,20,21,22) |
| InChIKey | WSYZWQUQDWFTKS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|