C10H16F2O3S — CID 129061676
3-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoropropane-1-sulfonic acid (PubChem CID 129061676) has the molecular formula C10H16F2O3S and a molecular weight of 254.30 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoropropane-1-sulfonic acid.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061676 |
| Molecular Formula | C10H16F2O3S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanyl)-2,2-difluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CC(F)(F)CC1CC2CCC1C2 |
| InChI | InChI=1S/C10H16F2O3S/c11-10(12,6-16(13,14)15)5-9-4-7-1-2-8(9)3-7/h7-9H,1-6H2,(H,13,14,15) |
| InChIKey | OQQXIZWCLPAICS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|