C16H26O6S2 — CID 89439705
1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid (PubChem CID 89439705) has the molecular formula C16H26O6S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid.
| Compound Name | 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 89439705 |
| Molecular Formula | C16H26O6S2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)CC(C1CC2CCC1C2)(C1CC2CCC1C2)S(=O)(=O)O |
| InChI | InChI=1S/C16H26O6S2/c17-23(18,19)9-16(24(20,21)22,14-7-10-1-3-12(14)5-10)15-8-11-2-4-13(15)6-11/h10-15H,1-9H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | QOIVMZRIICAHIP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|