1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid

C16H26O6S2 — CID 89439705

IUPAC1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid
SMILESO=S(=O)(O)CC(C1CC2CCC1C2)(C1CC2CCC1C2)S(=O)(=O)O
InChIInChI=1S/C16H26O6S2/c17-23(18,19)9-16(24(20,21)22,14-7-10-1-3-12(14)5-10)15-8-11-2-4-13(15)6-11/h10-15H,1-9H2,(H,17,18,19)(H,20,21,22)
InChIKeyQOIVMZRIICAHIP-UHFFFAOYSA-N
MW378.51 g/mol
LogP2.37
Rot. Bonds5

About 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid

1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid (PubChem CID 89439705) has the molecular formula C16H26O6S2 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid.

Molecular Properties

Compound Name1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid
PubChem CID89439705
Molecular FormulaC16H26O6S2
Molecular Weight378.51 g/mol
Exact Mass378.12
IUPAC Name1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid
SMILESO=S(=O)(O)CC(C1CC2CCC1C2)(C1CC2CCC1C2)S(=O)(=O)O
InChIInChI=1S/C16H26O6S2/c17-23(18,19)9-16(24(20,21)22,14-7-10-1-3-12(14)5-10)15-8-11-2-4-13(15)6-11/h10-15H,1-9H2,(H,17,18,19)(H,20,21,22)
InChIKeyQOIVMZRIICAHIP-UHFFFAOYSA-N
XLogP2.37
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500378.51
LogP ≤ 52.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid?
The IUPAC name of 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid (CID 89439705) is 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid.
What is the SMILES notation for 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid?
The canonical SMILES for 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid is O=S(=O)(O)CC(C1CC2CCC1C2)(C1CC2CCC1C2)S(=O)(=O)O.
What is the InChIKey of 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid?
The InChIKey is QOIVMZRIICAHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O6S2/c17-23(18,19)9-16(24(20,21)22,14-7-10-1-3-12(14)5-10)15-8-11-2-4-13(15)6-11/h10-15H,1-9H2,(H,17,18,19)(H,20,21,22).
What are the key properties of 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid?
1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid has a molecular weight of 378.51 g/mol, XLogP of 2.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(2-bicyclo[2.2.1]heptanyl)ethane-1,2-disulfonic acid is sourced from PubChem (CID 89439705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).