C9H12F3O3S- — CID 59628556
2-(2-bicyclo[2.2.1]heptanyl)-1,2,2-trifluoroethanesulfonate (PubChem CID 59628556) has the molecular formula C9H12F3O3S- and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,2,2-trifluoroethanesulfonate.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 59628556 |
| Molecular Formula | C9H12F3O3S- |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,2,2-trifluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C9H13F3O3S/c10-8(16(13,14)15)9(11,12)7-4-5-1-2-6(7)3-5/h5-8H,1-4H2,(H,13,14,15)/p-1 |
| InChIKey | YBVVCESXBKEQDS-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|