C14H16F2O2S — CID 163297766
2-[benzenesulfonyl(difluoro)methyl]bicyclo[2.2.1]heptane (PubChem CID 163297766) has the molecular formula C14H16F2O2S and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-[benzenesulfonyl(difluoro)methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[benzenesulfonyl(difluoro)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 163297766 |
| Molecular Formula | C14H16F2O2S |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[benzenesulfonyl(difluoro)methyl]bicyclo[2.2.1]heptane |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H16F2O2S/c15-14(16,13-9-10-6-7-11(13)8-10)19(17,18)12-4-2-1-3-5-12/h1-5,10-11,13H,6-9H2 |
| InChIKey | SMNLQKPBZBEDGB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |