C16H18F2O3S — CID 163297667
1-[5-[benzenesulfonyl(difluoro)methyl]-2-bicyclo[2.2.1]heptanyl]ethanone (PubChem CID 163297667) has the molecular formula C16H18F2O3S and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-[5-[benzenesulfonyl(difluoro)methyl]-2-bicyclo[2.2.1]heptanyl]ethanone.
| Compound Name | 1-[5-[benzenesulfonyl(difluoro)methyl]-2-bicyclo[2.2.1]heptanyl]ethanone |
|---|---|
| PubChem CID | 163297667 |
| Molecular Formula | C16H18F2O3S |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 1-[5-[benzenesulfonyl(difluoro)methyl]-2-bicyclo[2.2.1]heptanyl]ethanone |
| SMILES | CC(=O)C1CC2CC1CC2C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18F2O3S/c1-10(19)14-8-12-7-11(14)9-15(12)16(17,18)22(20,21)13-5-3-2-4-6-13/h2-6,11-12,14-15H,7-9H2,1H3 |
| InChIKey | LVTCZMYSDJTEDI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |