C9H13F4IO3S — CID 172679832
2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;hydroiodide (PubChem CID 172679832) has the molecular formula C9H13F4IO3S and a molecular weight of 404.16 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;hydroiodide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;hydroiodide |
|---|---|
| PubChem CID | 172679832 |
| Molecular Formula | C9H13F4IO3S |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;hydroiodide |
| SMILES | I.O=S(=O)(O)C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C9H12F4O3S.HI/c10-8(11,9(12,13)17(14,15)16)7-4-5-1-2-6(7)3-5;/h5-7H,1-4H2,(H,14,15,16);1H |
| InChIKey | AFYGOSGWUVUPKR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|