C11H17FO3S — CID 123809858
1-(2-bicyclo[2.2.1]heptanyl)-1-fluoro-2-methylprop-2-ene-1-sulfonic acid (PubChem CID 123809858) has the molecular formula C11H17FO3S and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-1-fluoro-2-methylprop-2-ene-1-sulfonic acid.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-1-fluoro-2-methylprop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 123809858 |
| Molecular Formula | C11H17FO3S |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-1-fluoro-2-methylprop-2-ene-1-sulfonic acid |
| SMILES | C=C(C)C(F)(C1CC2CCC1C2)S(=O)(=O)O |
| InChI | InChI=1S/C11H17FO3S/c1-7(2)11(12,16(13,14)15)10-6-8-3-4-9(10)5-8/h8-10H,1,3-6H2,2H3,(H,13,14,15) |
| InChIKey | GNFYTMMGRCHAIS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|