C19H32F4O3S — CID 87984539
decyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87984539) has the molecular formula C19H32F4O3S and a molecular weight of 416.52 g/mol. Its IUPAC name is decyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | decyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87984539 |
| Molecular Formula | C19H32F4O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | decyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCCCCCCCCCOS(=O)(=O)C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C19H32F4O3S/c1-2-3-4-5-6-7-8-9-12-26-27(24,25)19(22,23)18(20,21)17-14-15-10-11-16(17)13-15/h15-17H,2-14H2,1H3 |
| InChIKey | AWOYLEIDQJMJDM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|