C13H26F4N4O3S — CID 161300570
1,1-diaminobutyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;hydrazine (PubChem CID 161300570) has the molecular formula C13H26F4N4O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is 1,1-diaminobutyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;hydrazine.
| Compound Name | 1,1-diaminobutyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;hydrazine |
|---|---|
| PubChem CID | 161300570 |
| Molecular Formula | C13H26F4N4O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1,1-diaminobutyl 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;hydrazine |
| SMILES | CCCC(N)(N)OS(=O)(=O)C(F)(F)C(F)(F)C1CC2CCC1C2.NN |
| InChI | InChI=1S/C13H22F4N2O3S.H4N2/c1-2-5-11(18,19)22-23(20,21)13(16,17)12(14,15)10-7-8-3-4-9(10)6-8;1-2/h8-10H,2-7,18-19H2,1H3;1-2H2 |
| InChIKey | VHOCRIUHFNMNKW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|