C17H25N2O2S+ — CID 11878969
1-(benzenesulfonyl)-4-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium (PubChem CID 11878969) has the molecular formula C17H25N2O2S+ and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium.
| Compound Name | 1-(benzenesulfonyl)-4-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium |
|---|---|
| PubChem CID | 11878969 |
| Molecular Formula | C17H25N2O2S+ |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium |
| SMILES | O=S(=O)(c1ccccc1)N1CC[NH+]([C@@H]2C[C@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C17H24N2O2S/c20-22(21,16-4-2-1-3-5-16)19-10-8-18(9-11-19)17-13-14-6-7-15(17)12-14/h1-5,14-15,17H,6-13H2/p+1/t14-,15+,17+/m0/s1 |
| InChIKey | YGRLWPDLQHFGFO-ZMSDIMECSA-O |
| XLogP | 0.76 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |