C12H21N2O+ — CID 11865383
4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbaldehyde (PubChem CID 11865383) has the molecular formula C12H21N2O+ and a molecular weight of 209.31 g/mol. Its IUPAC name is 4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbaldehyde.
| Compound Name | 4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbaldehyde |
|---|---|
| PubChem CID | 11865383 |
| Molecular Formula | C12H21N2O+ |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazin-4-ium-1-carbaldehyde |
| SMILES | O=CN1CC[NH+]([C@H]2C[C@@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C12H20N2O/c15-9-13-3-5-14(6-4-13)12-8-10-1-2-11(12)7-10/h9-12H,1-8H2/p+1/t10-,11+,12+/m1/s1 |
| InChIKey | RCOBELWWYCKOCS-WOPDTQHZSA-O |
| XLogP | -0.47 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|