C12H23N2O+ — CID 6938555
4-[(1R,3S)-3-methylcyclohexyl]piperazin-4-ium-1-carbaldehyde (PubChem CID 6938555) has the molecular formula C12H23N2O+ and a molecular weight of 211.33 g/mol. Its IUPAC name is 4-[(1R,3S)-3-methylcyclohexyl]piperazin-4-ium-1-carbaldehyde.
| Compound Name | 4-[(1R,3S)-3-methylcyclohexyl]piperazin-4-ium-1-carbaldehyde |
|---|---|
| PubChem CID | 6938555 |
| Molecular Formula | C12H23N2O+ |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 4-[(1R,3S)-3-methylcyclohexyl]piperazin-4-ium-1-carbaldehyde |
| SMILES | C[C@H]1CCC[C@@H]([NH+]2CCN(C=O)CC2)C1 |
| InChI | InChI=1S/C12H22N2O/c1-11-3-2-4-12(9-11)14-7-5-13(10-15)6-8-14/h10-12H,2-9H2,1H3/p+1/t11-,12+/m0/s1 |
| InChIKey | NZYWGSAPGWWQQO-NWDGAFQWSA-O |
| XLogP | -0.08 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|