C12H22N2O — CID 758116
4-[(1S,3S)-3-methylcyclohexyl]piperazine-1-carbaldehyde (PubChem CID 758116) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-[(1S,3S)-3-methylcyclohexyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[(1S,3S)-3-methylcyclohexyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 758116 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 4-[(1S,3S)-3-methylcyclohexyl]piperazine-1-carbaldehyde |
| SMILES | C[C@H]1CCC[C@H](N2CCN(C=O)CC2)C1 |
| InChI | InChI=1S/C12H22N2O/c1-11-3-2-4-12(9-11)14-7-5-13(10-15)6-8-14/h10-12H,2-9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | NZYWGSAPGWWQQO-RYUDHWBXSA-N |
| XLogP | 1.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|