C13H26N2 — CID 784145
1-ethyl-4-[(1S,3S)-3-methylcyclohexyl]piperazine (PubChem CID 784145) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-ethyl-4-[(1S,3S)-3-methylcyclohexyl]piperazine.
| Compound Name | 1-ethyl-4-[(1S,3S)-3-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 784145 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-ethyl-4-[(1S,3S)-3-methylcyclohexyl]piperazine |
| SMILES | CCN1CCN([C@H]2CCC[C@H](C)C2)CC1 |
| InChI | InChI=1S/C13H26N2/c1-3-14-7-9-15(10-8-14)13-6-4-5-12(2)11-13/h12-13H,3-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | MZHSWNHFTBHSNI-STQMWFEESA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |