C13H27N3 — CID 90132085
3-(4-ethyl-1,4-diazepan-1-yl)cyclohexan-1-amine (PubChem CID 90132085) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 3-(4-ethyl-1,4-diazepan-1-yl)cyclohexan-1-amine.
| Compound Name | 3-(4-ethyl-1,4-diazepan-1-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 90132085 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 3-(4-ethyl-1,4-diazepan-1-yl)cyclohexan-1-amine |
| SMILES | CCN1CCCN(C2CCCC(N)C2)CC1 |
| InChI | InChI=1S/C13H27N3/c1-2-15-7-4-8-16(10-9-15)13-6-3-5-12(14)11-13/h12-13H,2-11,14H2,1H3 |
| InChIKey | CNBTZWPLQUUANE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |