About 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane
4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane (PubChem CID 171641351) has the molecular formula C15H35N3
and a molecular weight of 257.47 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane.
Molecular Properties
| Compound Name | 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane |
| PubChem CID | 171641351 |
| Molecular Formula | C15H35N3 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.28 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane |
| SMILES | CCC.CCN1CCN(C2CCC(N)CC2)CC1.[H][H] |
| InChI | InChI=1S/C12H25N3.C3H8.H2/c1-2-14-7-9-15(10-8-14)12-5-3-11(13)4-6-12;1-3-2;/h11-12H,2-10,13H2,1H3;3H2,1-2H3;1H |
| InChIKey | QFVKFTVUCQSFRH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane?
The IUPAC name of 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane (CID 171641351) is 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane.
What is the SMILES notation for 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane?
The canonical SMILES for 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane is CCC.CCN1CCN(C2CCC(N)CC2)CC1.[H][H].
What is the InChIKey of 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane?
The InChIKey is QFVKFTVUCQSFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3.C3H8.H2/c1-2-14-7-9-15(10-8-14)12-5-3-11(13)4-6-12;1-3-2;/h11-12H,2-10,13H2,1H3;3H2,1-2H3;1H.
What are the key properties of 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane?
4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane has a molecular weight of 257.47 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethylpiperazin-1-yl)cyclohexan-1-amine;molecular hydrogen;propane is sourced from PubChem (CID 171641351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).