C12H23N3O — CID 169448440
1-[4-[(1S,3R)-3-aminocyclohexyl]piperazin-1-yl]ethanone (PubChem CID 169448440) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-[4-[(1S,3R)-3-aminocyclohexyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(1S,3R)-3-aminocyclohexyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 169448440 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-[4-[(1S,3R)-3-aminocyclohexyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN([C@H]2CCC[C@@H](N)C2)CC1 |
| InChI | InChI=1S/C12H23N3O/c1-10(16)14-5-7-15(8-6-14)12-4-2-3-11(13)9-12/h11-12H,2-9,13H2,1H3/t11-,12+/m1/s1 |
| InChIKey | ACXTTWGANQTENC-NEPJUHHUSA-N |
| XLogP | 0.42 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |