C15H29N — CID 167208270
1-(3,7-dimethylcyclooctyl)piperidine (PubChem CID 167208270) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 1-(3,7-dimethylcyclooctyl)piperidine.
| Compound Name | 1-(3,7-dimethylcyclooctyl)piperidine |
|---|---|
| PubChem CID | 167208270 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 1-(3,7-dimethylcyclooctyl)piperidine |
| SMILES | CC1CCCC(C)CC(N2CCCCC2)C1 |
| InChI | InChI=1S/C15H29N/c1-13-7-6-8-14(2)12-15(11-13)16-9-4-3-5-10-16/h13-15H,3-12H2,1-2H3 |
| InChIKey | HGUWNFFHGFPKEU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |