C10H20ClNO4 — CID 44887480
2-methyl-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium perchlorate (PubChem CID 44887480) has the molecular formula C10H20ClNO4 and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-methyl-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium perchlorate.
| Compound Name | 2-methyl-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium perchlorate |
|---|---|
| PubChem CID | 44887480 |
| Molecular Formula | C10H20ClNO4 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-methyl-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium perchlorate |
| SMILES | CC1CC[NH+]2CCCCC2C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C10H19N.ClHO4/c1-9-5-7-11-6-3-2-4-10(11)8-9;2-1(3,4)5/h9-10H,2-8H2,1H3;(H,2,3,4,5) |
| InChIKey | GLKVMHIGTMMDIZ-UHFFFAOYSA-N |
| XLogP | -3.90 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |