C11H20NO+ — CID 18555426
4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]morpholin-4-ium (PubChem CID 18555426) has the molecular formula C11H20NO+ and a molecular weight of 182.29 g/mol. Its IUPAC name is 4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]morpholin-4-ium.
| Compound Name | 4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]morpholin-4-ium |
|---|---|
| PubChem CID | 18555426 |
| Molecular Formula | C11H20NO+ |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 4-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]morpholin-4-ium |
| SMILES | C1C[NH+]([C@H]2C[C@H]3CC[C@H]2C3)CCO1 |
| InChI | InChI=1S/C11H19NO/c1-2-10-7-9(1)8-11(10)12-3-5-13-6-4-12/h9-11H,1-8H2/p+1/t9-,10-,11-/m0/s1 |
| InChIKey | LDVODLJMMNMQAV-DCAQKATOSA-O |
| XLogP | 0.09 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |