C11H16Cl3NO — CID 134892606
(3,5,5-trimethylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate (PubChem CID 134892606) has the molecular formula C11H16Cl3NO and a molecular weight of 284.61 g/mol. Its IUPAC name is (3,5,5-trimethylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate.
| Compound Name | (3,5,5-trimethylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 134892606 |
| Molecular Formula | C11H16Cl3NO |
| Molecular Weight | 284.61 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | (3,5,5-trimethylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1C=C(C)CC(C)(C)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3NO/c1-7-4-8(6-10(2,3)5-7)16-9(15)11(12,13)14/h4,8,15H,5-6H2,1-3H3/b15-9+ |
| InChIKey | DEQCAFIDYJHHKI-OQLLNIDSSA-N |
| XLogP | 4.49 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|