C13H18Cl3NO — CID 135037993
[(E)-3-[(1R)-4-methylcyclohex-3-en-1-yl]but-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 135037993) has the molecular formula C13H18Cl3NO and a molecular weight of 310.65 g/mol. Its IUPAC name is [(E)-3-[(1R)-4-methylcyclohex-3-en-1-yl]but-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-3-[(1R)-4-methylcyclohex-3-en-1-yl]but-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 135037993 |
| Molecular Formula | C13H18Cl3NO |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | [(E)-3-[(1R)-4-methylcyclohex-3-en-1-yl]but-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C(\C)[C@H]1CC=C(C)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H18Cl3NO/c1-9-3-5-11(6-4-9)10(2)7-8-18-12(17)13(14,15)16/h3,7,11,17H,4-6,8H2,1-2H3/b10-7+,17-12+/t11-/m0/s1 |
| InChIKey | RBGABRKHKVLMFE-XUGAAFMGSA-N |
| XLogP | 5.04 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|