C11H18Cl3NO — CID 11346712
[(E,4R)-4-methyloct-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11346712) has the molecular formula C11H18Cl3NO and a molecular weight of 286.63 g/mol. Its IUPAC name is [(E,4R)-4-methyloct-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,4R)-4-methyloct-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11346712 |
| Molecular Formula | C11H18Cl3NO |
| Molecular Weight | 286.63 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [(E,4R)-4-methyloct-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/[C@H](C)CCCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO/c1-3-4-6-9(2)7-5-8-16-10(15)11(12,13)14/h5,7,9,15H,3-4,6,8H2,1-2H3/b7-5+,15-10-/t9-/m1/s1 |
| InChIKey | OUVDCAFVSYXKJW-LTSGHAOESA-N |
| XLogP | 4.73 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|