C9H14Cl3NO — CID 11448297
[(E)-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11448297) has the molecular formula C9H14Cl3NO and a molecular weight of 258.58 g/mol. Its IUPAC name is [(E)-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11448297 |
| Molecular Formula | C9H14Cl3NO |
| Molecular Weight | 258.58 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | [(E)-5-methylhex-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/CC(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl3NO/c1-7(2)5-3-4-6-14-8(13)9(10,11)12/h3-4,7,13H,5-6H2,1-2H3/b4-3+,13-8- |
| InChIKey | BSIAYCYRRIMLSR-ASIDLTKZSA-N |
| XLogP | 3.95 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|