C17H26Cl3NO — CID 102210011
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2,2,2-trichloroethanimidate (PubChem CID 102210011) has the molecular formula C17H26Cl3NO and a molecular weight of 366.76 g/mol. Its IUPAC name is [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102210011 |
| Molecular Formula | C17H26Cl3NO |
| Molecular Weight | 366.76 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H26Cl3NO/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-22-16(21)17(18,19)20/h7,9,11,21H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+,21-16- |
| InChIKey | RSKGHYPRFHXITH-NAKIYFMUSA-N |
| XLogP | 6.77 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|