C14H22Cl3NO — CID 102183844
2-(4-tert-butylcyclohexylidene)ethyl 2,2,2-trichloroethanimidate (PubChem CID 102183844) has the molecular formula C14H22Cl3NO and a molecular weight of 326.70 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexylidene)ethyl 2,2,2-trichloroethanimidate.
| Compound Name | 2-(4-tert-butylcyclohexylidene)ethyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102183844 |
| Molecular Formula | C14H22Cl3NO |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-(4-tert-butylcyclohexylidene)ethyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OCC=C1CCC(C(C)(C)C)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22Cl3NO/c1-13(2,3)11-6-4-10(5-7-11)8-9-19-12(18)14(15,16)17/h8,11,18H,4-7,9H2,1-3H3/b10-8-,18-12+ |
| InChIKey | NPJVYCZQACBQCG-IJUNAIDGSA-N |
| XLogP | 5.51 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|