C9H12Cl3NO — CID 10658772
(3-methylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate (PubChem CID 10658772) has the molecular formula C9H12Cl3NO and a molecular weight of 256.56 g/mol. Its IUPAC name is (3-methylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate.
| Compound Name | (3-methylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 10658772 |
| Molecular Formula | C9H12Cl3NO |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | (3-methylcyclohex-2-en-1-yl) 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1C=C(C)CCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3NO/c1-6-3-2-4-7(5-6)14-8(13)9(10,11)12/h5,7,13H,2-4H2,1H3/b13-8+ |
| InChIKey | XZGHZYDSZFJHQW-MDWZMJQESA-N |
| XLogP | 3.85 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|