C8H9Cl4NO — CID 57036640
[(1R)-2-chlorocyclohex-2-en-1-yl] 2,2,2-trichloro-N-deuterioethanimidate (PubChem CID 57036640) has the molecular formula C8H9Cl4NO and a molecular weight of 277.98 g/mol. Its IUPAC name is [(1R)-2-chlorocyclohex-2-en-1-yl] 2,2,2-trichloro-N-deuterioethanimidate.
| Compound Name | [(1R)-2-chlorocyclohex-2-en-1-yl] 2,2,2-trichloro-N-deuterioethanimidate |
|---|---|
| PubChem CID | 57036640 |
| Molecular Formula | C8H9Cl4NO |
| Molecular Weight | 277.98 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | [(1R)-2-chlorocyclohex-2-en-1-yl] 2,2,2-trichloro-N-deuterioethanimidate |
| SMILES | [2H]/N=C(/O[C@@H]1CCCC=C1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H9Cl4NO/c9-5-3-1-2-4-6(5)14-7(13)8(10,11)12/h3,6,13H,1-2,4H2/b13-7+/t6-/m1/s1/i/hD |
| InChIKey | KPPXFKMEOFBGGJ-GEKWPOGASA-N |
| XLogP | 4.03 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.98 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|