About (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate
(2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate (PubChem CID 140971942) has the molecular formula C8H11Cl2NO
and a molecular weight of 208.09 g/mol. Its IUPAC name is (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate.
Molecular Properties
| Compound Name | (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate |
| PubChem CID | 140971942 |
| Molecular Formula | C8H11Cl2NO |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate |
| SMILES | CC(=NCl)OC1CCCC=C1Cl |
| InChI | InChI=1S/C8H11Cl2NO/c1-6(11-10)12-8-5-3-2-4-7(8)9/h4,8H,2-3,5H2,1H3 |
| InChIKey | NTISZEVNEOAAHW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate?
The IUPAC name of (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate (CID 140971942) is (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate.
What is the SMILES notation for (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate?
The canonical SMILES for (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate is CC(=NCl)OC1CCCC=C1Cl.
What is the InChIKey of (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate?
The InChIKey is NTISZEVNEOAAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Cl2NO/c1-6(11-10)12-8-5-3-2-4-7(8)9/h4,8H,2-3,5H2,1H3.
What are the key properties of (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate?
(2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate has a molecular weight of 208.09 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorocyclohex-2-en-1-yl) N-chloroethanimidate is sourced from PubChem (CID 140971942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).