C10H10Cl6N2O2 — CID 11384112
[(1S,2S)-2-(2,2,2-trichloroethanimidoyl)oxycyclohex-3-en-1-yl] 2,2,2-trichloroethanimidate (PubChem CID 11384112) has the molecular formula C10H10Cl6N2O2 and a molecular weight of 402.92 g/mol. Its IUPAC name is [(1S,2S)-2-(2,2,2-trichloroethanimidoyl)oxycyclohex-3-en-1-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1S,2S)-2-(2,2,2-trichloroethanimidoyl)oxycyclohex-3-en-1-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11384112 |
| Molecular Formula | C10H10Cl6N2O2 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | [(1S,2S)-2-(2,2,2-trichloroethanimidoyl)oxycyclohex-3-en-1-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1C=CCC[C@@H]1O/C(=N/[H])C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl6N2O2/c11-9(12,13)7(17)19-5-3-1-2-4-6(5)20-8(18)10(14,15)16/h1,3,5-6,17-18H,2,4H2/b17-7+,18-8+/t5-,6-/m0/s1 |
| InChIKey | ANWLWLOFNUZYCC-OWGRWTIUSA-N |
| XLogP | 4.80 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|