C13H18Cl6N2O2 — CID 53260516
[(Z)-4-(2,2,2-trichloroethanimidoyl)oxynon-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 53260516) has the molecular formula C13H18Cl6N2O2 and a molecular weight of 447.02 g/mol. Its IUPAC name is [(Z)-4-(2,2,2-trichloroethanimidoyl)oxynon-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z)-4-(2,2,2-trichloroethanimidoyl)oxynon-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 53260516 |
| Molecular Formula | C13H18Cl6N2O2 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 443.95 |
| IUPAC Name | [(Z)-4-(2,2,2-trichloroethanimidoyl)oxynon-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C\C(CCCCC)O/C(=N/[H])C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H18Cl6N2O2/c1-2-3-4-6-9(23-11(21)13(17,18)19)7-5-8-22-10(20)12(14,15)16/h5,7,9,20-21H,2-4,6,8H2,1H3/b7-5-,20-10+,21-11+ |
| InChIKey | DUCMXPKCGWXVKB-CTAVCDCJSA-N |
| XLogP | 6.22 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|