C11H18Cl3NO2 — CID 70676204
[(E)-4-hydroxynon-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 70676204) has the molecular formula C11H18Cl3NO2 and a molecular weight of 302.63 g/mol. Its IUPAC name is [(E)-4-hydroxynon-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-4-hydroxynon-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 70676204 |
| Molecular Formula | C11H18Cl3NO2 |
| Molecular Weight | 302.63 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [(E)-4-hydroxynon-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/C(O)CCCCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO2/c1-2-3-4-6-9(16)7-5-8-17-10(15)11(12,13)14/h5,7,9,15-16H,2-4,6,8H2,1H3/b7-5+,15-10- |
| InChIKey | XWLBIQKEKPGFOG-MSLGXNKOSA-N |
| XLogP | 3.85 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|