C16H26Cl3NO2 — CID 70676207
[(2E)-4-hydroxytetradeca-2,13-dienyl] 2,2,2-trichloroethanimidate (PubChem CID 70676207) has the molecular formula C16H26Cl3NO2 and a molecular weight of 370.75 g/mol. Its IUPAC name is [(2E)-4-hydroxytetradeca-2,13-dienyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2E)-4-hydroxytetradeca-2,13-dienyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 70676207 |
| Molecular Formula | C16H26Cl3NO2 |
| Molecular Weight | 370.75 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(2E)-4-hydroxytetradeca-2,13-dienyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/C(O)CCCCCCCCC=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H26Cl3NO2/c1-2-3-4-5-6-7-8-9-11-14(21)12-10-13-22-15(20)16(17,18)19/h2,10,12,14,20-21H,1,3-9,11,13H2/b12-10+,20-15- |
| InChIKey | UESAIRNFYDAUMJ-HKNOJCFBSA-N |
| XLogP | 5.57 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.75 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|