C11H16Cl3NO2 — CID 176784720
[(1R,4S)-4-butoxycyclopent-2-en-1-yl] 2,2,2-trichloroethanimidate (PubChem CID 176784720) has the molecular formula C11H16Cl3NO2 and a molecular weight of 300.61 g/mol. Its IUPAC name is [(1R,4S)-4-butoxycyclopent-2-en-1-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(1R,4S)-4-butoxycyclopent-2-en-1-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 176784720 |
| Molecular Formula | C11H16Cl3NO2 |
| Molecular Weight | 300.61 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | [(1R,4S)-4-butoxycyclopent-2-en-1-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1C=C[C@@H](OCCCC)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3NO2/c1-2-3-6-16-8-4-5-9(7-8)17-10(15)11(12,13)14/h4-5,8-9,15H,2-3,6-7H2,1H3/b15-10+/t8-,9+/m1/s1 |
| InChIKey | WXKCDVMJGGEYBZ-SFBSIPHCSA-N |
| XLogP | 3.86 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|