C14H22Cl3NO3 — CID 15738403
[(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 15738403) has the molecular formula C14H22Cl3NO3 and a molecular weight of 358.69 g/mol. Its IUPAC name is [(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 15738403 |
| Molecular Formula | C14H22Cl3NO3 |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [(E,1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H](/C=C/CCCC)[C@H]1COC(C)(C)O1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22Cl3NO3/c1-4-5-6-7-8-10(20-12(18)14(15,16)17)11-9-19-13(2,3)21-11/h7-8,10-11,18H,4-6,9H2,1-3H3/b8-7+,18-12+/t10-,11-/m1/s1 |
| InChIKey | LXKKRXGSVDLHCM-LEQKCWLSSA-N |
| XLogP | 4.62 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|