C18H28Cl3NO3 — CID 10982538
[(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate (PubChem CID 10982538) has the molecular formula C18H28Cl3NO3 and a molecular weight of 412.79 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 10982538 |
| Molecular Formula | C18H28Cl3NO3 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1C=C[C@@H]2OC(CCCCC)(CCCCC)O[C@@H]21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H28Cl3NO3/c1-3-5-7-11-17(12-8-6-4-2)24-14-10-9-13(15(14)25-17)23-16(22)18(19,20)21/h9-10,13-15,22H,3-8,11-12H2,1-2H3/b22-16+/t13-,14+,15-/m1/s1 |
| InChIKey | AZYPSEAGNDLVFW-HKNAJHMHSA-N |
| XLogP | 5.93 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|