C17H30Cl3NO3 — CID 56650373
[(E,4S)-4-(methoxymethoxy)tridec-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 56650373) has the molecular formula C17H30Cl3NO3 and a molecular weight of 402.79 g/mol. Its IUPAC name is [(E,4S)-4-(methoxymethoxy)tridec-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,4S)-4-(methoxymethoxy)tridec-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 56650373 |
| Molecular Formula | C17H30Cl3NO3 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [(E,4S)-4-(methoxymethoxy)tridec-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/[C@H](CCCCCCCCC)OCOC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H30Cl3NO3/c1-3-4-5-6-7-8-9-11-15(24-14-22-2)12-10-13-23-16(21)17(18,19)20/h10,12,15,21H,3-9,11,13-14H2,1-2H3/b12-10+,21-16-/t15-/m0/s1 |
| InChIKey | LCLYEEUDLBSBGN-DZBYRQPYSA-N |
| XLogP | 6.04 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|