C17H28Cl3NO4 — CID 45101034
[(Z)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]dec-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 45101034) has the molecular formula C17H28Cl3NO4 and a molecular weight of 416.77 g/mol. Its IUPAC name is [(Z)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]dec-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]dec-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 45101034 |
| Molecular Formula | C17H28Cl3NO4 |
| Molecular Weight | 416.77 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [(Z)-4-[(2-methylpropan-2-yl)oxycarbonyloxy]dec-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C\C(CCCCCC)OC(=O)OC(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H28Cl3NO4/c1-5-6-7-8-10-13(24-15(22)25-16(2,3)4)11-9-12-23-14(21)17(18,19)20/h9,11,13,21H,5-8,10,12H2,1-4H3/b11-9-,21-14- |
| InChIKey | VIGCBIHNQPEZLD-VMMTYSIESA-N |
| XLogP | 6.20 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.77 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|